C28H28N6O6 — CID 87517731
3-[(2-methoxyphenyl)diazenyl]-5-[2-[3-[(2-methoxyphenyl)diazenyl]-4-methyl-2,6-dioxo-3H-pyridin-5-yl]ethyl]-4-methyl-3H-pyridine-2,6-dione (PubChem CID 87517731) has the molecular formula C28H28N6O6 and a molecular weight of 544.57 g/mol. Its IUPAC name is 3-[(2-methoxyphenyl)diazenyl]-5-[2-[3-[(2-methoxyphenyl)diazenyl]-4-methyl-2,6-dioxo-3H-pyridin-5-yl]ethyl]-4-methyl-3H-pyridine-2,6-dione.
| Compound Name | 3-[(2-methoxyphenyl)diazenyl]-5-[2-[3-[(2-methoxyphenyl)diazenyl]-4-methyl-2,6-dioxo-3H-pyridin-5-yl]ethyl]-4-methyl-3H-pyridine-2,6-dione |
|---|---|
| PubChem CID | 87517731 |
| Molecular Formula | C28H28N6O6 |
| Molecular Weight | 544.57 g/mol |
| Exact Mass | 544.21 |
| IUPAC Name | 3-[(2-methoxyphenyl)diazenyl]-5-[2-[3-[(2-methoxyphenyl)diazenyl]-4-methyl-2,6-dioxo-3H-pyridin-5-yl]ethyl]-4-methyl-3H-pyridine-2,6-dione |
| SMILES | COc1ccccc1/N=N/C1C(=O)NC(=O)C(CCC2=C(C)C(/N=N/c3ccccc3OC)C(=O)NC2=O)=C1C |
| InChI | InChI=1S/C28H28N6O6/c1-15-17(25(35)29-27(37)23(15)33-31-19-9-5-7-11-21(19)39-3)13-14-18-16(2)24(28(38)30-26(18)36)34-32-20-10-6-8-12-22(20)40-4/h5-12,23-24H,13-14H2,1-4H3,(H,29,35,37)(H,30,36,38)/b33-31+,34-32+ |
| InChIKey | FRKATRNUOZAQCX-FMWAKIAMSA-N |
| XLogP | 4.03 |
| TPSA | 160.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|