About (4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl) 4-fluorobenzenesulfonate
(4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl) 4-fluorobenzenesulfonate (PubChem CID 87518044) has the molecular formula C16H14FNO5S
and a molecular weight of 351.36 g/mol. Its IUPAC name is (4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl) 4-fluorobenzenesulfonate.
Molecular Properties
| Compound Name | (4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl) 4-fluorobenzenesulfonate |
| PubChem CID | 87518044 |
| Molecular Formula | C16H14FNO5S |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | (4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl) 4-fluorobenzenesulfonate |
| SMILES | CC1(C)OC(=O)Nc2ccc(OS(=O)(=O)c3ccc(F)cc3)cc21 |
| InChI | InChI=1S/C16H14FNO5S/c1-16(2)13-9-11(5-8-14(13)18-15(19)22-16)23-24(20,21)12-6-3-10(17)4-7-12/h3-9H,1-2H3,(H,18,19) |
| InChIKey | DVRROAGWRMXPHE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl) 4-fluorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl) 4-fluorobenzenesulfonate?
The IUPAC name of (4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl) 4-fluorobenzenesulfonate (CID 87518044) is (4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl) 4-fluorobenzenesulfonate.
What is the SMILES notation for (4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl) 4-fluorobenzenesulfonate?
The canonical SMILES for (4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl) 4-fluorobenzenesulfonate is CC1(C)OC(=O)Nc2ccc(OS(=O)(=O)c3ccc(F)cc3)cc21.
What is the InChIKey of (4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl) 4-fluorobenzenesulfonate?
The InChIKey is DVRROAGWRMXPHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14FNO5S/c1-16(2)13-9-11(5-8-14(13)18-15(19)22-16)23-24(20,21)12-6-3-10(17)4-7-12/h3-9H,1-2H3,(H,18,19).
What are the key properties of (4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl) 4-fluorobenzenesulfonate?
(4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl) 4-fluorobenzenesulfonate has a molecular weight of 351.36 g/mol, XLogP of 3.39, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl) 4-fluorobenzenesulfonate is sourced from PubChem (CID 87518044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).