C21H28BFN2O3S — CID 87518677
N-(5-tert-butyl-1,3-thiazol-2-yl)-2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide (PubChem CID 87518677) has the molecular formula C21H28BFN2O3S and a molecular weight of 418.34 g/mol. Its IUPAC name is N-(5-tert-butyl-1,3-thiazol-2-yl)-2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide.
| Compound Name | N-(5-tert-butyl-1,3-thiazol-2-yl)-2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 87518677 |
| Molecular Formula | C21H28BFN2O3S |
| Molecular Weight | 418.34 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N-(5-tert-butyl-1,3-thiazol-2-yl)-2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
| SMILES | CC(C)(C)c1cnc(NC(=O)Cc2ccc(B3OC(C)(C)C(C)(C)O3)cc2F)s1 |
| InChI | InChI=1S/C21H28BFN2O3S/c1-19(2,3)16-12-24-18(29-16)25-17(26)10-13-8-9-14(11-15(13)23)22-27-20(4,5)21(6,7)28-22/h8-9,11-12H,10H2,1-7H3,(H,24,25,26) |
| InChIKey | VCQRJUKNPPIZKE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|