C11H19NO3 — CID 87518848
tert-butyl (2S)-3,4-dideuterio-2-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 87518848) has the molecular formula C11H19NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is tert-butyl (2S)-3,4-dideuterio-2-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl (2S)-3,4-dideuterio-2-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 87518848 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | tert-butyl (2S)-3,4-dideuterio-2-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | [2H]C1=CCN(C(=O)OC(C)(C)C)[C@H](CO)C1[2H] |
| InChI | InChI=1S/C11H19NO3/c1-11(2,3)15-10(14)12-7-5-4-6-9(12)8-13/h4-5,9,13H,6-8H2,1-3H3/t9-/m0/s1/i4D,6D/t6?,9- |
| InChIKey | LTMIDZWWNNIEPG-DBIULADXSA-N |
| XLogP | 1.54 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|