About 3-[(11Z,14Z)-icosa-11,14-dien-2-yl]oxy-N-methylpropan-1-amine
3-[(11Z,14Z)-icosa-11,14-dien-2-yl]oxy-N-methylpropan-1-amine (PubChem CID 87519160) has the molecular formula C24H47NO
and a molecular weight of 365.65 g/mol. Its IUPAC name is 3-[(11Z,14Z)-icosa-11,14-dien-2-yl]oxy-N-methylpropan-1-amine.
Molecular Properties
| Compound Name | 3-[(11Z,14Z)-icosa-11,14-dien-2-yl]oxy-N-methylpropan-1-amine |
| PubChem CID | 87519160 |
| Molecular Formula | C24H47NO |
| Molecular Weight | 365.65 g/mol |
| Exact Mass | 365.37 |
| IUPAC Name | 3-[(11Z,14Z)-icosa-11,14-dien-2-yl]oxy-N-methylpropan-1-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(C)OCCCNC |
| InChI | InChI=1S/C24H47NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21-24(2)26-23-20-22-25-3/h8-9,11-12,24-25H,4-7,10,13-23H2,1-3H3/b9-8-,12-11- |
| InChIKey | YDGQEYNXQMYGHJ-MURFETPASA-N |
| XLogP | 7.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.65 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(11Z,14Z)-icosa-11,14-dien-2-yl]oxy-N-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(11Z,14Z)-icosa-11,14-dien-2-yl]oxy-N-methylpropan-1-amine?
The IUPAC name of 3-[(11Z,14Z)-icosa-11,14-dien-2-yl]oxy-N-methylpropan-1-amine (CID 87519160) is 3-[(11Z,14Z)-icosa-11,14-dien-2-yl]oxy-N-methylpropan-1-amine.
What is the SMILES notation for 3-[(11Z,14Z)-icosa-11,14-dien-2-yl]oxy-N-methylpropan-1-amine?
The canonical SMILES for 3-[(11Z,14Z)-icosa-11,14-dien-2-yl]oxy-N-methylpropan-1-amine is CCCCC/C=C\C/C=C\CCCCCCCCC(C)OCCCNC.
What is the InChIKey of 3-[(11Z,14Z)-icosa-11,14-dien-2-yl]oxy-N-methylpropan-1-amine?
The InChIKey is YDGQEYNXQMYGHJ-MURFETPASA-N. The full InChI is InChI=1S/C24H47NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21-24(2)26-23-20-22-25-3/h8-9,11-12,24-25H,4-7,10,13-23H2,1-3H3/b9-8-,12-11-.
What are the key properties of 3-[(11Z,14Z)-icosa-11,14-dien-2-yl]oxy-N-methylpropan-1-amine?
3-[(11Z,14Z)-icosa-11,14-dien-2-yl]oxy-N-methylpropan-1-amine has a molecular weight of 365.65 g/mol, XLogP of 7.20, 20 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(11Z,14Z)-icosa-11,14-dien-2-yl]oxy-N-methylpropan-1-amine is sourced from PubChem (CID 87519160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).