About disodium;decane-1,10-disulfonate
disodium;decane-1,10-disulfonate (PubChem CID 87519177) has the molecular formula C10H20Na2O6S2
and a molecular weight of 346.38 g/mol. Its IUPAC name is disodium;decane-1,10-disulfonate.
Molecular Properties
| Compound Name | disodium;decane-1,10-disulfonate |
| PubChem CID | 87519177 |
| Molecular Formula | C10H20Na2O6S2 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | disodium;decane-1,10-disulfonate |
| SMILES | O=S(=O)([O-])CCCCCCCCCCS(=O)(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C10H22O6S2.2Na/c11-17(12,13)9-7-5-3-1-2-4-6-8-10-18(14,15)16;;/h1-10H2,(H,11,12,13)(H,14,15,16);;/q;2*+1/p-2 |
| InChIKey | ZNOJFMHOMYZJIP-UHFFFAOYSA-L |
| XLogP | -4.79 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | -4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze disodium;decane-1,10-disulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;decane-1,10-disulfonate?
The IUPAC name of disodium;decane-1,10-disulfonate (CID 87519177) is disodium;decane-1,10-disulfonate.
What is the SMILES notation for disodium;decane-1,10-disulfonate?
The canonical SMILES for disodium;decane-1,10-disulfonate is O=S(=O)([O-])CCCCCCCCCCS(=O)(=O)[O-].[Na+].[Na+].
What is the InChIKey of disodium;decane-1,10-disulfonate?
The InChIKey is ZNOJFMHOMYZJIP-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H22O6S2.2Na/c11-17(12,13)9-7-5-3-1-2-4-6-8-10-18(14,15)16;;/h1-10H2,(H,11,12,13)(H,14,15,16);;/q;2*+1/p-2.
What are the key properties of disodium;decane-1,10-disulfonate?
disodium;decane-1,10-disulfonate has a molecular weight of 346.38 g/mol, XLogP of -4.79, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;decane-1,10-disulfonate is sourced from PubChem (CID 87519177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).