C26H21F3N4O4S — CID 87519358
(2,2,2-trifluoroacetyl) (2S)-3-methyl-2-[[4-[4-([1,3]thiazolo[5,4-b]pyridin-2-ylamino)phenyl]benzoyl]amino]butanoate (PubChem CID 87519358) has the molecular formula C26H21F3N4O4S and a molecular weight of 542.54 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (2S)-3-methyl-2-[[4-[4-([1,3]thiazolo[5,4-b]pyridin-2-ylamino)phenyl]benzoyl]amino]butanoate.
| Compound Name | (2,2,2-trifluoroacetyl) (2S)-3-methyl-2-[[4-[4-([1,3]thiazolo[5,4-b]pyridin-2-ylamino)phenyl]benzoyl]amino]butanoate |
|---|---|
| PubChem CID | 87519358 |
| Molecular Formula | C26H21F3N4O4S |
| Molecular Weight | 542.54 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (2S)-3-methyl-2-[[4-[4-([1,3]thiazolo[5,4-b]pyridin-2-ylamino)phenyl]benzoyl]amino]butanoate |
| SMILES | CC(C)[C@H](NC(=O)c1ccc(-c2ccc(Nc3nc4cccnc4s3)cc2)cc1)C(=O)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C26H21F3N4O4S/c1-14(2)20(23(35)37-24(36)26(27,28)29)33-21(34)17-7-5-15(6-8-17)16-9-11-18(12-10-16)31-25-32-19-4-3-13-30-22(19)38-25/h3-14,20H,1-2H3,(H,31,32)(H,33,34)/t20-/m0/s1 |
| InChIKey | AMMBAERKHQEYJM-FQEVSTJZSA-N |
| XLogP | 5.49 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.54 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|