About 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;methylsulfinylmethane
2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;methylsulfinylmethane (PubChem CID 87519421) has the molecular formula C12H22N2O9S
and a molecular weight of 370.38 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;methylsulfinylmethane.
Molecular Properties
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;methylsulfinylmethane |
| PubChem CID | 87519421 |
| Molecular Formula | C12H22N2O9S |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;methylsulfinylmethane |
| SMILES | CS(C)=O.O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C10H16N2O8.C2H6OS/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;1-4(2)3/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);1-2H3 |
| InChIKey | DNCQBBKVHNMYSV-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 172.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;methylsulfinylmethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;methylsulfinylmethane?
The IUPAC name of 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;methylsulfinylmethane (CID 87519421) is 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;methylsulfinylmethane.
What is the SMILES notation for 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;methylsulfinylmethane?
The canonical SMILES for 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;methylsulfinylmethane is CS(C)=O.O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O.
What is the InChIKey of 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;methylsulfinylmethane?
The InChIKey is DNCQBBKVHNMYSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O8.C2H6OS/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;1-4(2)3/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);1-2H3.
What are the key properties of 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;methylsulfinylmethane?
2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;methylsulfinylmethane has a molecular weight of 370.38 g/mol, XLogP of -2.08, 11 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;methylsulfinylmethane is sourced from PubChem (CID 87519421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).