C42H78N2O2 — CID 87519728
[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] N-[3-(methylamino)propyl]carbamate (PubChem CID 87519728) has the molecular formula C42H78N2O2 and a molecular weight of 643.10 g/mol. Its IUPAC name is [(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] N-[3-(methylamino)propyl]carbamate.
| Compound Name | [(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] N-[3-(methylamino)propyl]carbamate |
|---|---|
| PubChem CID | 87519728 |
| Molecular Formula | C42H78N2O2 |
| Molecular Weight | 643.10 g/mol |
| Exact Mass | 642.61 |
| IUPAC Name | [(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl] N-[3-(methylamino)propyl]carbamate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)OC(=O)NCCCNC |
| InChI | InChI=1S/C42H78N2O2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-37-41(46-42(45)44-40-36-39-43-3)38-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,41,43H,4-11,16-17,22-40H2,1-3H3,(H,44,45)/b14-12-,15-13-,20-18-,21-19- |
| InChIKey | DUAPWCOMOYLYMM-QYCRHRGJSA-N |
| XLogP | 13.10 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.10 |
| LogP ≤ 5 | 13.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|