C34H30F6O6 — CID 87520446
4-[1,1,1,3,3,3-hexafluoro-2-[4-[2-hydroxy-3-[4-[[4-(oxiran-2-ylmethoxy)phenyl]methyl]phenoxy]propoxy]phenyl]propan-2-yl]phenol (PubChem CID 87520446) has the molecular formula C34H30F6O6 and a molecular weight of 648.60 g/mol. Its IUPAC name is 4-[1,1,1,3,3,3-hexafluoro-2-[4-[2-hydroxy-3-[4-[[4-(oxiran-2-ylmethoxy)phenyl]methyl]phenoxy]propoxy]phenyl]propan-2-yl]phenol.
| Compound Name | 4-[1,1,1,3,3,3-hexafluoro-2-[4-[2-hydroxy-3-[4-[[4-(oxiran-2-ylmethoxy)phenyl]methyl]phenoxy]propoxy]phenyl]propan-2-yl]phenol |
|---|---|
| PubChem CID | 87520446 |
| Molecular Formula | C34H30F6O6 |
| Molecular Weight | 648.60 g/mol |
| Exact Mass | 648.19 |
| IUPAC Name | 4-[1,1,1,3,3,3-hexafluoro-2-[4-[2-hydroxy-3-[4-[[4-(oxiran-2-ylmethoxy)phenyl]methyl]phenoxy]propoxy]phenyl]propan-2-yl]phenol |
| SMILES | Oc1ccc(C(c2ccc(OCC(O)COc3ccc(Cc4ccc(OCC5CO5)cc4)cc3)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C34H30F6O6/c35-33(36,37)32(34(38,39)40,24-5-9-26(41)10-6-24)25-7-15-30(16-8-25)44-19-27(42)18-43-28-11-1-22(2-12-28)17-23-3-13-29(14-4-23)45-20-31-21-46-31/h1-16,27,31,41-42H,17-21H2 |
| InChIKey | QRZSSHWGMHSDRV-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.60 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|