C25H31N5O — CID 87520977
3-[2-[3-(2,8-diazaspiro[4.5]decan-2-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]-2,2-dimethylpropanal (PubChem CID 87520977) has the molecular formula C25H31N5O and a molecular weight of 417.56 g/mol. Its IUPAC name is 3-[2-[3-(2,8-diazaspiro[4.5]decan-2-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]-2,2-dimethylpropanal.
| Compound Name | 3-[2-[3-(2,8-diazaspiro[4.5]decan-2-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]-2,2-dimethylpropanal |
|---|---|
| PubChem CID | 87520977 |
| Molecular Formula | C25H31N5O |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | 3-[2-[3-(2,8-diazaspiro[4.5]decan-2-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]-2,2-dimethylpropanal |
| SMILES | CC(C)(C=O)Cc1c[nH]c2ncc(-c3cccc(N4CCC5(CCNCC5)C4)c3)nc12 |
| InChI | InChI=1S/C25H31N5O/c1-24(2,17-31)13-19-14-27-23-22(19)29-21(15-28-23)18-4-3-5-20(12-18)30-11-8-25(16-30)6-9-26-10-7-25/h3-5,12,14-15,17,26H,6-11,13,16H2,1-2H3,(H,27,28) |
| InChIKey | LXGKFJJYBNFOFA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|