C12H26O18P2 — CID 87521417
[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] dihydrogen phosphate (PubChem CID 87521417) has the molecular formula C12H26O18P2 and a molecular weight of 520.27 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] dihydrogen phosphate.
| Compound Name | [(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 87521417 |
| Molecular Formula | C12H26O18P2 |
| Molecular Weight | 520.27 g/mol |
| Exact Mass | 520.06 |
| IUPAC Name | [(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] dihydrogen phosphate |
| SMILES | O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)COP(=O)(O)O.O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/2C6H13O9P/c2*7-1-3(8)5(10)6(11)4(9)2-15-16(12,13)14/h2*1,3-6,8-11H,2H2,(H2,12,13,14)/t2*3-,4+,5+,6+/m00/s1 |
| InChIKey | ODNAKJNMMDXFKM-UUBOPVPUSA-N |
| XLogP | -6.52 |
| TPSA | 329.50 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.27 |
| LogP ≤ 5 | -6.52 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|