C20H20F2N4O — CID 87521740
3-[2-[3-(3,3-difluoroazetidin-1-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]-2,2-dimethylpropanal (PubChem CID 87521740) has the molecular formula C20H20F2N4O and a molecular weight of 370.40 g/mol. Its IUPAC name is 3-[2-[3-(3,3-difluoroazetidin-1-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]-2,2-dimethylpropanal.
| Compound Name | 3-[2-[3-(3,3-difluoroazetidin-1-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]-2,2-dimethylpropanal |
|---|---|
| PubChem CID | 87521740 |
| Molecular Formula | C20H20F2N4O |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 3-[2-[3-(3,3-difluoroazetidin-1-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]-2,2-dimethylpropanal |
| SMILES | CC(C)(C=O)Cc1c[nH]c2ncc(-c3cccc(N4CC(F)(F)C4)c3)nc12 |
| InChI | InChI=1S/C20H20F2N4O/c1-19(2,12-27)7-14-8-23-18-17(14)25-16(9-24-18)13-4-3-5-15(6-13)26-10-20(21,22)11-26/h3-6,8-9,12H,7,10-11H2,1-2H3,(H,23,24) |
| InChIKey | XLFJRYKBNBEBOE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|