C22H22N4O2 — CID 87521796
3-[2-[3-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]-2,2-dimethylpropanal (PubChem CID 87521796) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is 3-[2-[3-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]-2,2-dimethylpropanal.
| Compound Name | 3-[2-[3-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]-2,2-dimethylpropanal |
|---|---|
| PubChem CID | 87521796 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 3-[2-[3-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]-2,2-dimethylpropanal |
| SMILES | Cc1noc(C)c1-c1cccc(-c2cnc3[nH]cc(CC(C)(C)C=O)c3n2)c1 |
| InChI | InChI=1S/C22H22N4O2/c1-13-19(14(2)28-26-13)16-7-5-6-15(8-16)18-11-24-21-20(25-18)17(10-23-21)9-22(3,4)12-27/h5-8,10-12H,9H2,1-4H3,(H,23,24) |
| InChIKey | IJEJDPBQPUCNSO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|