About (E)-3,4-dimethylhex-3-ene-2,5-diol
(E)-3,4-dimethylhex-3-ene-2,5-diol (PubChem CID 87521818) has the molecular formula C8H16O2
and a molecular weight of 144.21 g/mol. Its IUPAC name is (E)-3,4-dimethylhex-3-ene-2,5-diol.
Molecular Properties
| Compound Name | (E)-3,4-dimethylhex-3-ene-2,5-diol |
| PubChem CID | 87521818 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | (E)-3,4-dimethylhex-3-ene-2,5-diol |
| SMILES | C/C(=C(/C)C(C)O)C(C)O |
| InChI | InChI=1S/C8H16O2/c1-5(7(3)9)6(2)8(4)10/h7-10H,1-4H3/b6-5+ |
| InChIKey | VFQOQCXUGDVRAP-AATRIKPKSA-N |
| XLogP | 1.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-3,4-dimethylhex-3-ene-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3,4-dimethylhex-3-ene-2,5-diol?
The IUPAC name of (E)-3,4-dimethylhex-3-ene-2,5-diol (CID 87521818) is (E)-3,4-dimethylhex-3-ene-2,5-diol.
What is the SMILES notation for (E)-3,4-dimethylhex-3-ene-2,5-diol?
The canonical SMILES for (E)-3,4-dimethylhex-3-ene-2,5-diol is C/C(=C(/C)C(C)O)C(C)O.
What is the InChIKey of (E)-3,4-dimethylhex-3-ene-2,5-diol?
The InChIKey is VFQOQCXUGDVRAP-AATRIKPKSA-N. The full InChI is InChI=1S/C8H16O2/c1-5(7(3)9)6(2)8(4)10/h7-10H,1-4H3/b6-5+.
What are the key properties of (E)-3,4-dimethylhex-3-ene-2,5-diol?
(E)-3,4-dimethylhex-3-ene-2,5-diol has a molecular weight of 144.21 g/mol, XLogP of 1.08, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3,4-dimethylhex-3-ene-2,5-diol is sourced from PubChem (CID 87521818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).