About 1-sulfanylpent-4-en-1-ol
1-sulfanylpent-4-en-1-ol (PubChem CID 87522201) has the molecular formula C5H10OS
and a molecular weight of 118.20 g/mol. Its IUPAC name is 1-sulfanylpent-4-en-1-ol.
Molecular Properties
| Compound Name | 1-sulfanylpent-4-en-1-ol |
| PubChem CID | 87522201 |
| Molecular Formula | C5H10OS |
| Molecular Weight | 118.20 g/mol |
| Exact Mass | 118.05 |
| IUPAC Name | 1-sulfanylpent-4-en-1-ol |
| SMILES | C=CCCC(O)S |
| InChI | InChI=1S/C5H10OS/c1-2-3-4-5(6)7/h2,5-7H,1,3-4H2 |
| InChIKey | PFSPIOKYWUZAGU-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-sulfanylpent-4-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-sulfanylpent-4-en-1-ol?
The IUPAC name of 1-sulfanylpent-4-en-1-ol (CID 87522201) is 1-sulfanylpent-4-en-1-ol.
What is the SMILES notation for 1-sulfanylpent-4-en-1-ol?
The canonical SMILES for 1-sulfanylpent-4-en-1-ol is C=CCCC(O)S.
What is the InChIKey of 1-sulfanylpent-4-en-1-ol?
The InChIKey is PFSPIOKYWUZAGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10OS/c1-2-3-4-5(6)7/h2,5-7H,1,3-4H2.
What are the key properties of 1-sulfanylpent-4-en-1-ol?
1-sulfanylpent-4-en-1-ol has a molecular weight of 118.20 g/mol, XLogP of 1.20, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-sulfanylpent-4-en-1-ol is sourced from PubChem (CID 87522201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).