C42H75O10P — CID 87523152
[1-[(2R)-2,3-bis[[(9Z,12Z)-octadeca-9,12-dienoyl]oxy]propoxy]-2,3-dihydroxypropyl]phosphonic acid (PubChem CID 87523152) has the molecular formula C42H75O10P and a molecular weight of 771.03 g/mol. Its IUPAC name is [1-[(2R)-2,3-bis[[(9Z,12Z)-octadeca-9,12-dienoyl]oxy]propoxy]-2,3-dihydroxypropyl]phosphonic acid.
| Compound Name | [1-[(2R)-2,3-bis[[(9Z,12Z)-octadeca-9,12-dienoyl]oxy]propoxy]-2,3-dihydroxypropyl]phosphonic acid |
|---|---|
| PubChem CID | 87523152 |
| Molecular Formula | C42H75O10P |
| Molecular Weight | 771.03 g/mol |
| Exact Mass | 770.51 |
| IUPAC Name | [1-[(2R)-2,3-bis[[(9Z,12Z)-octadeca-9,12-dienoyl]oxy]propoxy]-2,3-dihydroxypropyl]phosphonic acid |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC[C@H](COC(C(O)CO)P(=O)(O)O)OC(=O)CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C42H75O10P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-40(45)50-36-38(37-51-42(39(44)35-43)53(47,48)49)52-41(46)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,38-39,42-44H,3-10,15-16,21-37H2,1-2H3,(H2,47,48,49)/b13-11-,14-12-,19-17-,20-18-/t38-,39?,42?/m1/s1 |
| InChIKey | NIKGWOTWUQLTNQ-SQMDAVPNSA-N |
| XLogP | 9.94 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.03 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|