About 2-chloro-4-(4-fluorophenoxy)-6-methylpyrimidine;4-fluorophenol
2-chloro-4-(4-fluorophenoxy)-6-methylpyrimidine;4-fluorophenol (PubChem CID 87523274) has the molecular formula C17H13ClF2N2O2
and a molecular weight of 350.75 g/mol. Its IUPAC name is 2-chloro-4-(4-fluorophenoxy)-6-methylpyrimidine;4-fluorophenol.
Molecular Properties
| Compound Name | 2-chloro-4-(4-fluorophenoxy)-6-methylpyrimidine;4-fluorophenol |
| PubChem CID | 87523274 |
| Molecular Formula | C17H13ClF2N2O2 |
| Molecular Weight | 350.75 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 2-chloro-4-(4-fluorophenoxy)-6-methylpyrimidine;4-fluorophenol |
| SMILES | Cc1cc(Oc2ccc(F)cc2)nc(Cl)n1.Oc1ccc(F)cc1 |
| InChI | InChI=1S/C11H8ClFN2O.C6H5FO/c1-7-6-10(15-11(12)14-7)16-9-4-2-8(13)3-5-9;7-5-1-3-6(8)4-2-5/h2-6H,1H3;1-4,8H |
| InChIKey | VATLPAWLWGOXJP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.75 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-4-(4-fluorophenoxy)-6-methylpyrimidine;4-fluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-(4-fluorophenoxy)-6-methylpyrimidine;4-fluorophenol?
The IUPAC name of 2-chloro-4-(4-fluorophenoxy)-6-methylpyrimidine;4-fluorophenol (CID 87523274) is 2-chloro-4-(4-fluorophenoxy)-6-methylpyrimidine;4-fluorophenol.
What is the SMILES notation for 2-chloro-4-(4-fluorophenoxy)-6-methylpyrimidine;4-fluorophenol?
The canonical SMILES for 2-chloro-4-(4-fluorophenoxy)-6-methylpyrimidine;4-fluorophenol is Cc1cc(Oc2ccc(F)cc2)nc(Cl)n1.Oc1ccc(F)cc1.
What is the InChIKey of 2-chloro-4-(4-fluorophenoxy)-6-methylpyrimidine;4-fluorophenol?
The InChIKey is VATLPAWLWGOXJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClFN2O.C6H5FO/c1-7-6-10(15-11(12)14-7)16-9-4-2-8(13)3-5-9;7-5-1-3-6(8)4-2-5/h2-6H,1H3;1-4,8H.
What are the key properties of 2-chloro-4-(4-fluorophenoxy)-6-methylpyrimidine;4-fluorophenol?
2-chloro-4-(4-fluorophenoxy)-6-methylpyrimidine;4-fluorophenol has a molecular weight of 350.75 g/mol, XLogP of 4.90, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-(4-fluorophenoxy)-6-methylpyrimidine;4-fluorophenol is sourced from PubChem (CID 87523274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).