C21H21F3N4O4S — CID 87524279
[[4-(2-methyl-1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]sulfonyl-piperidin-4-ylamino] 2,2,2-trifluoroacetate (PubChem CID 87524279) has the molecular formula C21H21F3N4O4S and a molecular weight of 482.48 g/mol. Its IUPAC name is [[4-(2-methyl-1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]sulfonyl-piperidin-4-ylamino] 2,2,2-trifluoroacetate.
| Compound Name | [[4-(2-methyl-1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]sulfonyl-piperidin-4-ylamino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87524279 |
| Molecular Formula | C21H21F3N4O4S |
| Molecular Weight | 482.48 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | [[4-(2-methyl-1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]sulfonyl-piperidin-4-ylamino] 2,2,2-trifluoroacetate |
| SMILES | Cc1cc2c(-c3ccc(S(=O)(=O)N(OC(=O)C(F)(F)F)C4CCNCC4)cc3)ccnc2[nH]1 |
| InChI | InChI=1S/C21H21F3N4O4S/c1-13-12-18-17(8-11-26-19(18)27-13)14-2-4-16(5-3-14)33(30,31)28(15-6-9-25-10-7-15)32-20(29)21(22,23)24/h2-5,8,11-12,15,25H,6-7,9-10H2,1H3,(H,26,27) |
| InChIKey | NSTILUBJYMDCAB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|