About [4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]methyl methanesulfonate
[4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]methyl methanesulfonate (PubChem CID 87524284) has the molecular formula C19H21N3O5S2
and a molecular weight of 435.53 g/mol. Its IUPAC name is [4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]methyl methanesulfonate.
Molecular Properties
| Compound Name | [4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]methyl methanesulfonate |
| PubChem CID | 87524284 |
| Molecular Formula | C19H21N3O5S2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | [4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCc1cc2c(-c3ccc(S(=O)(=O)N4CCCC4)cc3)ccnc2[nH]1 |
| InChI | InChI=1S/C19H21N3O5S2/c1-28(23,24)27-13-15-12-18-17(8-9-20-19(18)21-15)14-4-6-16(7-5-14)29(25,26)22-10-2-3-11-22/h4-9,12H,2-3,10-11,13H2,1H3,(H,20,21) |
| InChIKey | XCKCFWJUZGIZQL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 109.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]methyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]methyl methanesulfonate?
The IUPAC name of [4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]methyl methanesulfonate (CID 87524284) is [4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]methyl methanesulfonate.
What is the SMILES notation for [4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]methyl methanesulfonate?
The canonical SMILES for [4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]methyl methanesulfonate is CS(=O)(=O)OCc1cc2c(-c3ccc(S(=O)(=O)N4CCCC4)cc3)ccnc2[nH]1.
What is the InChIKey of [4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]methyl methanesulfonate?
The InChIKey is XCKCFWJUZGIZQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O5S2/c1-28(23,24)27-13-15-12-18-17(8-9-20-19(18)21-15)14-4-6-16(7-5-14)29(25,26)22-10-2-3-11-22/h4-9,12H,2-3,10-11,13H2,1H3,(H,20,21).
What are the key properties of [4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]methyl methanesulfonate?
[4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]methyl methanesulfonate has a molecular weight of 435.53 g/mol, XLogP of 2.49, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-pyrrolidin-1-ylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl]methyl methanesulfonate is sourced from PubChem (CID 87524284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).