About bis(N-ethyl-N-propan-2-ylpropan-2-amine);hexanoyl heptanoate
bis(N-ethyl-N-propan-2-ylpropan-2-amine);hexanoyl heptanoate (PubChem CID 87524334) has the molecular formula C29H62N2O3
and a molecular weight of 486.83 g/mol. Its IUPAC name is bis(N-ethyl-N-propan-2-ylpropan-2-amine);hexanoyl heptanoate.
Molecular Properties
| Compound Name | bis(N-ethyl-N-propan-2-ylpropan-2-amine);hexanoyl heptanoate |
| PubChem CID | 87524334 |
| Molecular Formula | C29H62N2O3 |
| Molecular Weight | 486.83 g/mol |
| Exact Mass | 486.48 |
| IUPAC Name | bis(N-ethyl-N-propan-2-ylpropan-2-amine);hexanoyl heptanoate |
| SMILES | CCCCCCC(=O)OC(=O)CCCCC.CCN(C(C)C)C(C)C.CCN(C(C)C)C(C)C |
| InChI | InChI=1S/C13H24O3.2C8H19N/c1-3-5-7-9-11-13(15)16-12(14)10-8-6-4-2;2*1-6-9(7(2)3)8(4)5/h3-11H2,1-2H3;2*7-8H,6H2,1-5H3 |
| InChIKey | SXURSADVXBQSSV-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.83 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze bis(N-ethyl-N-propan-2-ylpropan-2-amine);hexanoyl heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(N-ethyl-N-propan-2-ylpropan-2-amine);hexanoyl heptanoate?
The IUPAC name of bis(N-ethyl-N-propan-2-ylpropan-2-amine);hexanoyl heptanoate (CID 87524334) is bis(N-ethyl-N-propan-2-ylpropan-2-amine);hexanoyl heptanoate.
What is the SMILES notation for bis(N-ethyl-N-propan-2-ylpropan-2-amine);hexanoyl heptanoate?
The canonical SMILES for bis(N-ethyl-N-propan-2-ylpropan-2-amine);hexanoyl heptanoate is CCCCCCC(=O)OC(=O)CCCCC.CCN(C(C)C)C(C)C.CCN(C(C)C)C(C)C.
What is the InChIKey of bis(N-ethyl-N-propan-2-ylpropan-2-amine);hexanoyl heptanoate?
The InChIKey is SXURSADVXBQSSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O3.2C8H19N/c1-3-5-7-9-11-13(15)16-12(14)10-8-6-4-2;2*1-6-9(7(2)3)8(4)5/h3-11H2,1-2H3;2*7-8H,6H2,1-5H3.
What are the key properties of bis(N-ethyl-N-propan-2-ylpropan-2-amine);hexanoyl heptanoate?
bis(N-ethyl-N-propan-2-ylpropan-2-amine);hexanoyl heptanoate has a molecular weight of 486.83 g/mol, XLogP of 7.86, 15 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(N-ethyl-N-propan-2-ylpropan-2-amine);hexanoyl heptanoate is sourced from PubChem (CID 87524334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).