C37H48F6O8S3 — CID 87524418
2,3-bis(4-octoxyphenyl)benzenethiol;1,1,2,2,3,3-hexafluoropropane-1,3-disulfonic acid (PubChem CID 87524418) has the molecular formula C37H48F6O8S3 and a molecular weight of 830.97 g/mol. Its IUPAC name is 2,3-bis(4-octoxyphenyl)benzenethiol;1,1,2,2,3,3-hexafluoropropane-1,3-disulfonic acid.
| Compound Name | 2,3-bis(4-octoxyphenyl)benzenethiol;1,1,2,2,3,3-hexafluoropropane-1,3-disulfonic acid |
|---|---|
| PubChem CID | 87524418 |
| Molecular Formula | C37H48F6O8S3 |
| Molecular Weight | 830.97 g/mol |
| Exact Mass | 830.24 |
| IUPAC Name | 2,3-bis(4-octoxyphenyl)benzenethiol;1,1,2,2,3,3-hexafluoropropane-1,3-disulfonic acid |
| SMILES | CCCCCCCCOc1ccc(-c2cccc(S)c2-c2ccc(OCCCCCCCC)cc2)cc1.O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C34H46O2S.C3H2F6O6S2/c1-3-5-7-9-11-13-26-35-30-22-18-28(19-23-30)32-16-15-17-33(37)34(32)29-20-24-31(25-21-29)36-27-14-12-10-8-6-4-2;4-1(5,2(6,7)16(10,11)12)3(8,9)17(13,14)15/h15-25,37H,3-14,26-27H2,1-2H3;(H,10,11,12)(H,13,14,15) |
| InChIKey | SIABGAXNESOAMK-UHFFFAOYSA-N |
| XLogP | 11.37 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.97 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|