About N-[[4-(2,6-dioxo-3-propyl-7H-purin-8-yl)phenoxy]methyl]-N-(2-hydroxyethyl)formamide
N-[[4-(2,6-dioxo-3-propyl-7H-purin-8-yl)phenoxy]methyl]-N-(2-hydroxyethyl)formamide (PubChem CID 87524658) has the molecular formula C18H21N5O5
and a molecular weight of 387.40 g/mol. Its IUPAC name is N-[[4-(2,6-dioxo-3-propyl-7H-purin-8-yl)phenoxy]methyl]-N-(2-hydroxyethyl)formamide.
Molecular Properties
| Compound Name | N-[[4-(2,6-dioxo-3-propyl-7H-purin-8-yl)phenoxy]methyl]-N-(2-hydroxyethyl)formamide |
| PubChem CID | 87524658 |
| Molecular Formula | C18H21N5O5 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | N-[[4-(2,6-dioxo-3-propyl-7H-purin-8-yl)phenoxy]methyl]-N-(2-hydroxyethyl)formamide |
| SMILES | CCCn1c(=O)[nH]c(=O)c2[nH]c(-c3ccc(OCN(C=O)CCO)cc3)nc21 |
| InChI | InChI=1S/C18H21N5O5/c1-2-7-23-16-14(17(26)21-18(23)27)19-15(20-16)12-3-5-13(6-4-12)28-11-22(10-25)8-9-24/h3-6,10,24H,2,7-9,11H2,1H3,(H,19,20)(H,21,26,27) |
| InChIKey | JEBLYFNKHQKWRO-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 133.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-[[4-(2,6-dioxo-3-propyl-7H-purin-8-yl)phenoxy]methyl]-N-(2-hydroxyethyl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-(2,6-dioxo-3-propyl-7H-purin-8-yl)phenoxy]methyl]-N-(2-hydroxyethyl)formamide?
The IUPAC name of N-[[4-(2,6-dioxo-3-propyl-7H-purin-8-yl)phenoxy]methyl]-N-(2-hydroxyethyl)formamide (CID 87524658) is N-[[4-(2,6-dioxo-3-propyl-7H-purin-8-yl)phenoxy]methyl]-N-(2-hydroxyethyl)formamide.
What is the SMILES notation for N-[[4-(2,6-dioxo-3-propyl-7H-purin-8-yl)phenoxy]methyl]-N-(2-hydroxyethyl)formamide?
The canonical SMILES for N-[[4-(2,6-dioxo-3-propyl-7H-purin-8-yl)phenoxy]methyl]-N-(2-hydroxyethyl)formamide is CCCn1c(=O)[nH]c(=O)c2[nH]c(-c3ccc(OCN(C=O)CCO)cc3)nc21.
What is the InChIKey of N-[[4-(2,6-dioxo-3-propyl-7H-purin-8-yl)phenoxy]methyl]-N-(2-hydroxyethyl)formamide?
The InChIKey is JEBLYFNKHQKWRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N5O5/c1-2-7-23-16-14(17(26)21-18(23)27)19-15(20-16)12-3-5-13(6-4-12)28-11-22(10-25)8-9-24/h3-6,10,24H,2,7-9,11H2,1H3,(H,19,20)(H,21,26,27).
What are the key properties of N-[[4-(2,6-dioxo-3-propyl-7H-purin-8-yl)phenoxy]methyl]-N-(2-hydroxyethyl)formamide?
N-[[4-(2,6-dioxo-3-propyl-7H-purin-8-yl)phenoxy]methyl]-N-(2-hydroxyethyl)formamide has a molecular weight of 387.40 g/mol, XLogP of 0.28, 9 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-(2,6-dioxo-3-propyl-7H-purin-8-yl)phenoxy]methyl]-N-(2-hydroxyethyl)formamide is sourced from PubChem (CID 87524658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).