C8H19NO6 — CID 87524691
2-[2-[bis(2-hydroxyethoxy)amino]ethoxy]ethanol (PubChem CID 87524691) has the molecular formula C8H19NO6 and a molecular weight of 225.24 g/mol. Its IUPAC name is 2-[2-[bis(2-hydroxyethoxy)amino]ethoxy]ethanol.
| Compound Name | 2-[2-[bis(2-hydroxyethoxy)amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 87524691 |
| Molecular Formula | C8H19NO6 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2-[2-[bis(2-hydroxyethoxy)amino]ethoxy]ethanol |
| SMILES | OCCOCCN(OCCO)OCCO |
| InChI | InChI=1S/C8H19NO6/c10-2-6-13-5-1-9(14-7-3-11)15-8-4-12/h10-12H,1-8H2 |
| InChIKey | XFXVBWDCFCUYQO-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 91.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|