C21H20F3N3O4S — CID 87524755
[cyclopentyl-[4-(2-methyl-1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]sulfonylamino] 2,2,2-trifluoroacetate (PubChem CID 87524755) has the molecular formula C21H20F3N3O4S and a molecular weight of 467.47 g/mol. Its IUPAC name is [cyclopentyl-[4-(2-methyl-1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]sulfonylamino] 2,2,2-trifluoroacetate.
| Compound Name | [cyclopentyl-[4-(2-methyl-1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]sulfonylamino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87524755 |
| Molecular Formula | C21H20F3N3O4S |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | [cyclopentyl-[4-(2-methyl-1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]sulfonylamino] 2,2,2-trifluoroacetate |
| SMILES | Cc1cc2c(-c3ccc(S(=O)(=O)N(OC(=O)C(F)(F)F)C4CCCC4)cc3)ccnc2[nH]1 |
| InChI | InChI=1S/C21H20F3N3O4S/c1-13-12-18-17(10-11-25-19(18)26-13)14-6-8-16(9-7-14)32(29,30)27(15-4-2-3-5-15)31-20(28)21(22,23)24/h6-12,15H,2-5H2,1H3,(H,25,26) |
| InChIKey | UIEAKZMXTYABFD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|