C8H6F13N — CID 87524931
1,1,2,2,3,3,4,4,5,6,7,8,8-tridecafluorooctan-1-amine (PubChem CID 87524931) has the molecular formula C8H6F13N and a molecular weight of 363.12 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,6,7,8,8-tridecafluorooctan-1-amine.
| Compound Name | 1,1,2,2,3,3,4,4,5,6,7,8,8-tridecafluorooctan-1-amine |
|---|---|
| PubChem CID | 87524931 |
| Molecular Formula | C8H6F13N |
| Molecular Weight | 363.12 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,6,7,8,8-tridecafluorooctan-1-amine |
| SMILES | NC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)C(F)C(F)F |
| InChI | InChI=1S/C8H6F13N/c9-1(2(10)4(12)13)3(11)5(14,15)6(16,17)7(18,19)8(20,21)22/h1-4H,22H2 |
| InChIKey | WGEDGCHCATZMPP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.12 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|