C17H28O2S — CID 87525098
(1R,4R,6R)-1-[(Z)-5-ethylsulfanyl-3-methylpent-3-en-1-ynyl]-2,2,6-trimethylcyclohexane-1,4-diol (PubChem CID 87525098) has the molecular formula C17H28O2S and a molecular weight of 296.48 g/mol. Its IUPAC name is (1R,4R,6R)-1-[(Z)-5-ethylsulfanyl-3-methylpent-3-en-1-ynyl]-2,2,6-trimethylcyclohexane-1,4-diol.
| Compound Name | (1R,4R,6R)-1-[(Z)-5-ethylsulfanyl-3-methylpent-3-en-1-ynyl]-2,2,6-trimethylcyclohexane-1,4-diol |
|---|---|
| PubChem CID | 87525098 |
| Molecular Formula | C17H28O2S |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (1R,4R,6R)-1-[(Z)-5-ethylsulfanyl-3-methylpent-3-en-1-ynyl]-2,2,6-trimethylcyclohexane-1,4-diol |
| SMILES | CCSC/C=C(/C)C#C[C@@]1(O)[C@H](C)C[C@@H](O)CC1(C)C |
| InChI | InChI=1S/C17H28O2S/c1-6-20-10-8-13(2)7-9-17(19)14(3)11-15(18)12-16(17,4)5/h8,14-15,18-19H,6,10-12H2,1-5H3/b13-8-/t14-,15-,17-/m1/s1 |
| InChIKey | UZGGZDNAMKXMNZ-YGCGPYGXSA-N |
| XLogP | 3.24 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|