C32H28F5N7O4S2 — CID 87525237
3-[3-[5-[2-[4-[2-(dimethylamino)ethoxy]anilino]pyrimidin-4-yl]-2-(2,2,2-trifluoroethylsulfonylamino)-1,3-thiazol-4-yl]phenyl]-2,6-difluorobenzamide (PubChem CID 87525237) has the molecular formula C32H28F5N7O4S2 and a molecular weight of 733.74 g/mol. Its IUPAC name is 3-[3-[5-[2-[4-[2-(dimethylamino)ethoxy]anilino]pyrimidin-4-yl]-2-(2,2,2-trifluoroethylsulfonylamino)-1,3-thiazol-4-yl]phenyl]-2,6-difluorobenzamide.
| Compound Name | 3-[3-[5-[2-[4-[2-(dimethylamino)ethoxy]anilino]pyrimidin-4-yl]-2-(2,2,2-trifluoroethylsulfonylamino)-1,3-thiazol-4-yl]phenyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 87525237 |
| Molecular Formula | C32H28F5N7O4S2 |
| Molecular Weight | 733.74 g/mol |
| Exact Mass | 733.16 |
| IUPAC Name | 3-[3-[5-[2-[4-[2-(dimethylamino)ethoxy]anilino]pyrimidin-4-yl]-2-(2,2,2-trifluoroethylsulfonylamino)-1,3-thiazol-4-yl]phenyl]-2,6-difluorobenzamide |
| SMILES | CN(C)CCOc1ccc(Nc2nccc(-c3sc(NS(=O)(=O)CC(F)(F)F)nc3-c3cccc(-c4ccc(F)c(C(N)=O)c4F)c3)n2)cc1 |
| InChI | InChI=1S/C32H28F5N7O4S2/c1-44(2)14-15-48-21-8-6-20(7-9-21)40-30-39-13-12-24(41-30)28-27(42-31(49-28)43-50(46,47)17-32(35,36)37)19-5-3-4-18(16-19)22-10-11-23(33)25(26(22)34)29(38)45/h3-13,16H,14-15,17H2,1-2H3,(H2,38,45)(H,42,43)(H,39,40,41) |
| InChIKey | FUBOTUDAUXSHRE-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 152.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.74 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |