C25H28N4O2 — CID 87525399
[1-[4-[[4-(tert-butylamino)-6-phenylpyrimidin-2-yl]amino]phenyl]cyclobutyl] formate (PubChem CID 87525399) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is [1-[4-[[4-(tert-butylamino)-6-phenylpyrimidin-2-yl]amino]phenyl]cyclobutyl] formate.
| Compound Name | [1-[4-[[4-(tert-butylamino)-6-phenylpyrimidin-2-yl]amino]phenyl]cyclobutyl] formate |
|---|---|
| PubChem CID | 87525399 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | [1-[4-[[4-(tert-butylamino)-6-phenylpyrimidin-2-yl]amino]phenyl]cyclobutyl] formate |
| SMILES | CC(C)(C)Nc1cc(-c2ccccc2)nc(Nc2ccc(C3(OC=O)CCC3)cc2)n1 |
| InChI | InChI=1S/C25H28N4O2/c1-24(2,3)29-22-16-21(18-8-5-4-6-9-18)27-23(28-22)26-20-12-10-19(11-13-20)25(31-17-30)14-7-15-25/h4-6,8-13,16-17H,7,14-15H2,1-3H3,(H2,26,27,28,29) |
| InChIKey | AZNGZFLVTFMFKM-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|