C24H28N2O5S — CID 87525402
3,4,5-tris(oxiran-2-ylmethyl)-6-[2-(oxiran-2-ylmethyl)phenyl]sulfinylbenzene-1,2-diamine (PubChem CID 87525402) has the molecular formula C24H28N2O5S and a molecular weight of 456.56 g/mol. Its IUPAC name is 3,4,5-tris(oxiran-2-ylmethyl)-6-[2-(oxiran-2-ylmethyl)phenyl]sulfinylbenzene-1,2-diamine.
| Compound Name | 3,4,5-tris(oxiran-2-ylmethyl)-6-[2-(oxiran-2-ylmethyl)phenyl]sulfinylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 87525402 |
| Molecular Formula | C24H28N2O5S |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 3,4,5-tris(oxiran-2-ylmethyl)-6-[2-(oxiran-2-ylmethyl)phenyl]sulfinylbenzene-1,2-diamine |
| SMILES | Nc1c(N)c(S(=O)c2ccccc2CC2CO2)c(CC2CO2)c(CC2CO2)c1CC1CO1 |
| InChI | InChI=1S/C24H28N2O5S/c25-22-19(7-16-11-30-16)18(6-15-10-29-15)20(8-17-12-31-17)24(23(22)26)32(27)21-4-2-1-3-13(21)5-14-9-28-14/h1-4,14-17H,5-12,25-26H2 |
| InChIKey | YGKVCCGIXUZEBT-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|