C23H20N2O5 — CID 8752563
[2-(4-nitroanilino)-2-oxoethyl] 3,3-diphenylpropanoate (PubChem CID 8752563) has the molecular formula C23H20N2O5 and a molecular weight of 404.42 g/mol. Its IUPAC name is [2-(4-nitroanilino)-2-oxoethyl] 3,3-diphenylpropanoate.
| Compound Name | [2-(4-nitroanilino)-2-oxoethyl] 3,3-diphenylpropanoate |
|---|---|
| PubChem CID | 8752563 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | [2-(4-nitroanilino)-2-oxoethyl] 3,3-diphenylpropanoate |
| SMILES | O=C(COC(=O)CC(c1ccccc1)c1ccccc1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H20N2O5/c26-22(24-19-11-13-20(14-12-19)25(28)29)16-30-23(27)15-21(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-14,21H,15-16H2,(H,24,26) |
| InChIKey | KJUWNOFBNIIBSS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|