About [[1-(4-chlorophenyl)-2,2,2-trifluoroethylidene]amino] trichloromethanesulfonate
[[1-(4-chlorophenyl)-2,2,2-trifluoroethylidene]amino] trichloromethanesulfonate (PubChem CID 87525807) has the molecular formula C9H4Cl4F3NO3S
and a molecular weight of 405.01 g/mol. Its IUPAC name is [[1-(4-chlorophenyl)-2,2,2-trifluoroethylidene]amino] trichloromethanesulfonate.
Molecular Properties
| Compound Name | [[1-(4-chlorophenyl)-2,2,2-trifluoroethylidene]amino] trichloromethanesulfonate |
| PubChem CID | 87525807 |
| Molecular Formula | C9H4Cl4F3NO3S |
| Molecular Weight | 405.01 g/mol |
| Exact Mass | 402.86 |
| IUPAC Name | [[1-(4-chlorophenyl)-2,2,2-trifluoroethylidene]amino] trichloromethanesulfonate |
| SMILES | O=S(=O)(ON=C(c1ccc(Cl)cc1)C(F)(F)F)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H4Cl4F3NO3S/c10-6-3-1-5(2-4-6)7(8(14,15)16)17-20-21(18,19)9(11,12)13/h1-4H |
| InChIKey | OOBCONXJCDSRKE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.01 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[1-(4-chlorophenyl)-2,2,2-trifluoroethylidene]amino] trichloromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[1-(4-chlorophenyl)-2,2,2-trifluoroethylidene]amino] trichloromethanesulfonate?
The IUPAC name of [[1-(4-chlorophenyl)-2,2,2-trifluoroethylidene]amino] trichloromethanesulfonate (CID 87525807) is [[1-(4-chlorophenyl)-2,2,2-trifluoroethylidene]amino] trichloromethanesulfonate.
What is the SMILES notation for [[1-(4-chlorophenyl)-2,2,2-trifluoroethylidene]amino] trichloromethanesulfonate?
The canonical SMILES for [[1-(4-chlorophenyl)-2,2,2-trifluoroethylidene]amino] trichloromethanesulfonate is O=S(=O)(ON=C(c1ccc(Cl)cc1)C(F)(F)F)C(Cl)(Cl)Cl.
What is the InChIKey of [[1-(4-chlorophenyl)-2,2,2-trifluoroethylidene]amino] trichloromethanesulfonate?
The InChIKey is OOBCONXJCDSRKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4Cl4F3NO3S/c10-6-3-1-5(2-4-6)7(8(14,15)16)17-20-21(18,19)9(11,12)13/h1-4H.
What are the key properties of [[1-(4-chlorophenyl)-2,2,2-trifluoroethylidene]amino] trichloromethanesulfonate?
[[1-(4-chlorophenyl)-2,2,2-trifluoroethylidene]amino] trichloromethanesulfonate has a molecular weight of 405.01 g/mol, XLogP of 4.28, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [[1-(4-chlorophenyl)-2,2,2-trifluoroethylidene]amino] trichloromethanesulfonate is sourced from PubChem (CID 87525807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).