About N-[(2Z)-3-methylpenta-2,4-dien-2-yl]methanimine
N-[(2Z)-3-methylpenta-2,4-dien-2-yl]methanimine (PubChem CID 87525876) has the molecular formula C7H11N
and a molecular weight of 109.17 g/mol. Its IUPAC name is N-[(2Z)-3-methylpenta-2,4-dien-2-yl]methanimine.
Molecular Properties
| Compound Name | N-[(2Z)-3-methylpenta-2,4-dien-2-yl]methanimine |
| PubChem CID | 87525876 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | N-[(2Z)-3-methylpenta-2,4-dien-2-yl]methanimine |
| SMILES | C=C/C(C)=C(/C)N=C |
| InChI | InChI=1S/C7H11N/c1-5-6(2)7(3)8-4/h5H,1,4H2,2-3H3/b7-6- |
| InChIKey | OYPRDUNBEQETJI-SREVYHEPSA-N |
| XLogP | 2.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2Z)-3-methylpenta-2,4-dien-2-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2Z)-3-methylpenta-2,4-dien-2-yl]methanimine?
The IUPAC name of N-[(2Z)-3-methylpenta-2,4-dien-2-yl]methanimine (CID 87525876) is N-[(2Z)-3-methylpenta-2,4-dien-2-yl]methanimine.
What is the SMILES notation for N-[(2Z)-3-methylpenta-2,4-dien-2-yl]methanimine?
The canonical SMILES for N-[(2Z)-3-methylpenta-2,4-dien-2-yl]methanimine is C=C/C(C)=C(/C)N=C.
What is the InChIKey of N-[(2Z)-3-methylpenta-2,4-dien-2-yl]methanimine?
The InChIKey is OYPRDUNBEQETJI-SREVYHEPSA-N. The full InChI is InChI=1S/C7H11N/c1-5-6(2)7(3)8-4/h5H,1,4H2,2-3H3/b7-6-.
What are the key properties of N-[(2Z)-3-methylpenta-2,4-dien-2-yl]methanimine?
N-[(2Z)-3-methylpenta-2,4-dien-2-yl]methanimine has a molecular weight of 109.17 g/mol, XLogP of 2.17, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2Z)-3-methylpenta-2,4-dien-2-yl]methanimine is sourced from PubChem (CID 87525876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).