About N-hydroxy-1,3-thiazole-5-carboxamide
N-hydroxy-1,3-thiazole-5-carboxamide (PubChem CID 87525999) has the molecular formula C4H4N2O2S
and a molecular weight of 144.16 g/mol. Its IUPAC name is N-hydroxy-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-hydroxy-1,3-thiazole-5-carboxamide |
| PubChem CID | 87525999 |
| Molecular Formula | C4H4N2O2S |
| Molecular Weight | 144.16 g/mol |
| Exact Mass | 144.00 |
| IUPAC Name | N-hydroxy-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NO)c1cncs1 |
| InChI | InChI=1S/C4H4N2O2S/c7-4(6-8)3-1-5-2-9-3/h1-2,8H,(H,6,7) |
| InChIKey | DJSTVAGEAPNZAE-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.16 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-1,3-thiazole-5-carboxamide?
The IUPAC name of N-hydroxy-1,3-thiazole-5-carboxamide (CID 87525999) is N-hydroxy-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N-hydroxy-1,3-thiazole-5-carboxamide?
The canonical SMILES for N-hydroxy-1,3-thiazole-5-carboxamide is O=C(NO)c1cncs1.
What is the InChIKey of N-hydroxy-1,3-thiazole-5-carboxamide?
The InChIKey is DJSTVAGEAPNZAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2S/c7-4(6-8)3-1-5-2-9-3/h1-2,8H,(H,6,7).
What are the key properties of N-hydroxy-1,3-thiazole-5-carboxamide?
N-hydroxy-1,3-thiazole-5-carboxamide has a molecular weight of 144.16 g/mol, XLogP of 0.26, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 87525999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).