C20H38O7 — CID 87526044
[(2R)-2-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] dodecanoate;oxirane (PubChem CID 87526044) has the molecular formula C20H38O7 and a molecular weight of 390.52 g/mol. Its IUPAC name is [(2R)-2-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] dodecanoate;oxirane.
| Compound Name | [(2R)-2-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] dodecanoate;oxirane |
|---|---|
| PubChem CID | 87526044 |
| Molecular Formula | C20H38O7 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | [(2R)-2-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] dodecanoate;oxirane |
| SMILES | C1CO1.CCCCCCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O |
| InChI | InChI=1S/C18H34O6.C2H4O/c1-2-3-4-5-6-7-8-9-10-11-16(21)23-13-15(20)18-17(22)14(19)12-24-18;1-2-3-1/h14-15,17-20,22H,2-13H2,1H3;1-2H2/t14-,15+,17+,18+;/m0./s1 |
| InChIKey | BPLIETYAQRWXOC-YHCMQLGNSA-N |
| XLogP | 1.95 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|