C14H22F3O4S2+ — CID 87526164
cyclohexylmethyl-(2-oxocyclohexyl)-(trifluoromethoxysulfonyl)sulfanium (PubChem CID 87526164) has the molecular formula C14H22F3O4S2+ and a molecular weight of 375.45 g/mol. Its IUPAC name is cyclohexylmethyl-(2-oxocyclohexyl)-(trifluoromethoxysulfonyl)sulfanium.
| Compound Name | cyclohexylmethyl-(2-oxocyclohexyl)-(trifluoromethoxysulfonyl)sulfanium |
|---|---|
| PubChem CID | 87526164 |
| Molecular Formula | C14H22F3O4S2+ |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | cyclohexylmethyl-(2-oxocyclohexyl)-(trifluoromethoxysulfonyl)sulfanium |
| SMILES | O=C1CCCCC1[S+](CC1CCCCC1)S(=O)(=O)OC(F)(F)F |
| InChI | InChI=1S/C14H22F3O4S2/c15-14(16,17)21-23(19,20)22(10-11-6-2-1-3-7-11)13-9-5-4-8-12(13)18/h11,13H,1-10H2/q+1 |
| InChIKey | SBYZIECIOJWHBG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|