About 5,6-ditert-butyl-5-hydroxycyclohexa-1,3-diene-1-carbaldehyde
5,6-ditert-butyl-5-hydroxycyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 87526646) has the molecular formula C15H24O2
and a molecular weight of 236.35 g/mol. Its IUPAC name is 5,6-ditert-butyl-5-hydroxycyclohexa-1,3-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 5,6-ditert-butyl-5-hydroxycyclohexa-1,3-diene-1-carbaldehyde |
| PubChem CID | 87526646 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 5,6-ditert-butyl-5-hydroxycyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | CC(C)(C)C1C(C=O)=CC=CC1(O)C(C)(C)C |
| InChI | InChI=1S/C15H24O2/c1-13(2,3)12-11(10-16)8-7-9-15(12,17)14(4,5)6/h7-10,12,17H,1-6H3 |
| InChIKey | IJZTVPMKVAYQDF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5,6-ditert-butyl-5-hydroxycyclohexa-1,3-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-ditert-butyl-5-hydroxycyclohexa-1,3-diene-1-carbaldehyde?
The IUPAC name of 5,6-ditert-butyl-5-hydroxycyclohexa-1,3-diene-1-carbaldehyde (CID 87526646) is 5,6-ditert-butyl-5-hydroxycyclohexa-1,3-diene-1-carbaldehyde.
What is the SMILES notation for 5,6-ditert-butyl-5-hydroxycyclohexa-1,3-diene-1-carbaldehyde?
The canonical SMILES for 5,6-ditert-butyl-5-hydroxycyclohexa-1,3-diene-1-carbaldehyde is CC(C)(C)C1C(C=O)=CC=CC1(O)C(C)(C)C.
What is the InChIKey of 5,6-ditert-butyl-5-hydroxycyclohexa-1,3-diene-1-carbaldehyde?
The InChIKey is IJZTVPMKVAYQDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O2/c1-13(2,3)12-11(10-16)8-7-9-15(12,17)14(4,5)6/h7-10,12,17H,1-6H3.
What are the key properties of 5,6-ditert-butyl-5-hydroxycyclohexa-1,3-diene-1-carbaldehyde?
5,6-ditert-butyl-5-hydroxycyclohexa-1,3-diene-1-carbaldehyde has a molecular weight of 236.35 g/mol, XLogP of 3.12, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-ditert-butyl-5-hydroxycyclohexa-1,3-diene-1-carbaldehyde is sourced from PubChem (CID 87526646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).