About 11-thia-14-azatricyclo[8.5.0.01,6]pentadeca-3,5,7,9-tetraene
11-thia-14-azatricyclo[8.5.0.01,6]pentadeca-3,5,7,9-tetraene (PubChem CID 87526712) has the molecular formula C13H15NS
and a molecular weight of 217.34 g/mol. Its IUPAC name is 11-thia-14-azatricyclo[8.5.0.01,6]pentadeca-3,5,7,9-tetraene.
Analyze 11-thia-14-azatricyclo[8.5.0.01,6]pentadeca-3,5,7,9-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-thia-14-azatricyclo[8.5.0.01,6]pentadeca-3,5,7,9-tetraene?
The IUPAC name of 11-thia-14-azatricyclo[8.5.0.01,6]pentadeca-3,5,7,9-tetraene (CID 87526712) is 11-thia-14-azatricyclo[8.5.0.01,6]pentadeca-3,5,7,9-tetraene.
What is the SMILES notation for 11-thia-14-azatricyclo[8.5.0.01,6]pentadeca-3,5,7,9-tetraene?
The canonical SMILES for 11-thia-14-azatricyclo[8.5.0.01,6]pentadeca-3,5,7,9-tetraene is C1=CCC23CNCCSC2=CC=CC3=C1.
What is the InChIKey of 11-thia-14-azatricyclo[8.5.0.01,6]pentadeca-3,5,7,9-tetraene?
The InChIKey is FANSGFZDEVSQCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NS/c1-2-7-13-10-14-8-9-15-12(13)6-3-5-11(13)4-1/h1-6,14H,7-10H2.
What are the key properties of 11-thia-14-azatricyclo[8.5.0.01,6]pentadeca-3,5,7,9-tetraene?
11-thia-14-azatricyclo[8.5.0.01,6]pentadeca-3,5,7,9-tetraene has a molecular weight of 217.34 g/mol, XLogP of 2.65, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-thia-14-azatricyclo[8.5.0.01,6]pentadeca-3,5,7,9-tetraene is sourced from PubChem (CID 87526712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).