C20H17ClFN5O3 — CID 87527537
formyl (3S)-3-[[2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]amino]bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 87527537) has the molecular formula C20H17ClFN5O3 and a molecular weight of 429.84 g/mol. Its IUPAC name is formyl (3S)-3-[[2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]amino]bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | formyl (3S)-3-[[2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]amino]bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 87527537 |
| Molecular Formula | C20H17ClFN5O3 |
| Molecular Weight | 429.84 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | formyl (3S)-3-[[2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]amino]bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | O=COC(=O)C1C2CCC(C2)[C@@H]1Nc1nc(-c2c[nH]c3ncc(Cl)cc23)ncc1F |
| InChI | InChI=1S/C20H17ClFN5O3/c21-11-4-12-13(6-24-17(12)23-5-11)18-25-7-14(22)19(27-18)26-16-10-2-1-9(3-10)15(16)20(29)30-8-28/h4-10,15-16H,1-3H2,(H,23,24)(H,25,26,27)/t9?,10?,15?,16-/m0/s1 |
| InChIKey | PZFGTHKLOKMTCU-AHYVENMTSA-N |
| XLogP | 3.34 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.84 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|