C7H3F11O4S2 — CID 87527597
2,2,3,3-tetrafluoro-5-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)thiolane 1,1-dioxide (PubChem CID 87527597) has the molecular formula C7H3F11O4S2 and a molecular weight of 424.21 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-5-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)thiolane 1,1-dioxide.
| Compound Name | 2,2,3,3-tetrafluoro-5-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 87527597 |
| Molecular Formula | C7H3F11O4S2 |
| Molecular Weight | 424.21 g/mol |
| Exact Mass | 423.93 |
| IUPAC Name | 2,2,3,3-tetrafluoro-5-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)thiolane 1,1-dioxide |
| SMILES | O=S1(=O)C(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)F)CC(F)(F)C1(F)F |
| InChI | InChI=1S/C7H3F11O4S2/c8-3(9)1-2(23(19,20)6(3,15)16)24(21,22)7(17,18)4(10,11)5(12,13)14/h2H,1H2 |
| InChIKey | CEANEYKERDRIGA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.21 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|