C8H5F11O4S2 — CID 87527670
2,2,3,3-tetrafluoro-6-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)thiane 1,1-dioxide (PubChem CID 87527670) has the molecular formula C8H5F11O4S2 and a molecular weight of 438.24 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-6-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)thiane 1,1-dioxide.
| Compound Name | 2,2,3,3-tetrafluoro-6-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 87527670 |
| Molecular Formula | C8H5F11O4S2 |
| Molecular Weight | 438.24 g/mol |
| Exact Mass | 437.95 |
| IUPAC Name | 2,2,3,3-tetrafluoro-6-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)thiane 1,1-dioxide |
| SMILES | O=S1(=O)C(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)F)CCC(F)(F)C1(F)F |
| InChI | InChI=1S/C8H5F11O4S2/c9-4(10)2-1-3(24(20,21)7(4,16)17)25(22,23)8(18,19)5(11,12)6(13,14)15/h3H,1-2H2 |
| InChIKey | WHFFWCLDYLBHJM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|