C14H7F13N4O3 — CID 87528239
[3-[[3,5-bis(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]methyl]-1-methyl-4-(trifluoromethyl)pyrazol-5-yl] hydrogen carbonate (PubChem CID 87528239) has the molecular formula C14H7F13N4O3 and a molecular weight of 526.21 g/mol. Its IUPAC name is [3-[[3,5-bis(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]methyl]-1-methyl-4-(trifluoromethyl)pyrazol-5-yl] hydrogen carbonate.
| Compound Name | [3-[[3,5-bis(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]methyl]-1-methyl-4-(trifluoromethyl)pyrazol-5-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 87528239 |
| Molecular Formula | C14H7F13N4O3 |
| Molecular Weight | 526.21 g/mol |
| Exact Mass | 526.03 |
| IUPAC Name | [3-[[3,5-bis(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]methyl]-1-methyl-4-(trifluoromethyl)pyrazol-5-yl] hydrogen carbonate |
| SMILES | Cn1nc(Cn2nc(C(F)(F)C(F)(F)F)cc2C(F)(F)C(F)(F)F)c(C(F)(F)F)c1OC(=O)O |
| InChI | InChI=1S/C14H7F13N4O3/c1-30-8(34-9(32)33)7(12(19,20)21)4(28-30)3-31-6(11(17,18)14(25,26)27)2-5(29-31)10(15,16)13(22,23)24/h2H,3H2,1H3,(H,32,33) |
| InChIKey | HPAKRSADVWLJFS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.21 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|