About magnesium;N,N-dimethyl-3-(phenoxy)propan-1-amine;chloride
magnesium;N,N-dimethyl-3-(phenoxy)propan-1-amine;chloride (PubChem CID 87528633) has the molecular formula C11H16ClMgNO
and a molecular weight of 238.01 g/mol. Its IUPAC name is magnesium;N,N-dimethyl-3-(phenoxy)propan-1-amine;chloride.
Molecular Properties
| Compound Name | magnesium;N,N-dimethyl-3-(phenoxy)propan-1-amine;chloride |
| PubChem CID | 87528633 |
| Molecular Formula | C11H16ClMgNO |
| Molecular Weight | 238.01 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | magnesium;N,N-dimethyl-3-(phenoxy)propan-1-amine;chloride |
| SMILES | CN(C)CCCOc1cc[c-]cc1.[Cl-].[Mg+2] |
| InChI | InChI=1S/C11H16NO.ClH.Mg/c1-12(2)9-6-10-13-11-7-4-3-5-8-11;;/h4-5,7-8H,6,9-10H2,1-2H3;1H;/q-1;;+2/p-1 |
| InChIKey | KCMDVNHYAAZPMJ-UHFFFAOYSA-M |
| XLogP | -1.56 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.01 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze magnesium;N,N-dimethyl-3-(phenoxy)propan-1-amine;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;N,N-dimethyl-3-(phenoxy)propan-1-amine;chloride?
The IUPAC name of magnesium;N,N-dimethyl-3-(phenoxy)propan-1-amine;chloride (CID 87528633) is magnesium;N,N-dimethyl-3-(phenoxy)propan-1-amine;chloride.
What is the SMILES notation for magnesium;N,N-dimethyl-3-(phenoxy)propan-1-amine;chloride?
The canonical SMILES for magnesium;N,N-dimethyl-3-(phenoxy)propan-1-amine;chloride is CN(C)CCCOc1cc[c-]cc1.[Cl-].[Mg+2].
What is the InChIKey of magnesium;N,N-dimethyl-3-(phenoxy)propan-1-amine;chloride?
The InChIKey is KCMDVNHYAAZPMJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H16NO.ClH.Mg/c1-12(2)9-6-10-13-11-7-4-3-5-8-11;;/h4-5,7-8H,6,9-10H2,1-2H3;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;N,N-dimethyl-3-(phenoxy)propan-1-amine;chloride?
magnesium;N,N-dimethyl-3-(phenoxy)propan-1-amine;chloride has a molecular weight of 238.01 g/mol, XLogP of -1.56, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;N,N-dimethyl-3-(phenoxy)propan-1-amine;chloride is sourced from PubChem (CID 87528633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).