C27H25F3N6O7S — CID 87529105
ethyl 5-[2-(3,5-dimethoxyanilino)-4-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-5-yl]-2-(2-sulfonylethoxy)pyridine-3-carboxylate (PubChem CID 87529105) has the molecular formula C27H25F3N6O7S and a molecular weight of 634.59 g/mol. Its IUPAC name is ethyl 5-[2-(3,5-dimethoxyanilino)-4-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-5-yl]-2-(2-sulfonylethoxy)pyridine-3-carboxylate.
| Compound Name | ethyl 5-[2-(3,5-dimethoxyanilino)-4-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-5-yl]-2-(2-sulfonylethoxy)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 87529105 |
| Molecular Formula | C27H25F3N6O7S |
| Molecular Weight | 634.59 g/mol |
| Exact Mass | 634.15 |
| IUPAC Name | ethyl 5-[2-(3,5-dimethoxyanilino)-4-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-5-yl]-2-(2-sulfonylethoxy)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2cnc(Nc3cc(OC)cc(OC)c3)nc2-n2nc(C(F)(F)F)cc2C)cnc1OCC=S(=O)=O |
| InChI | InChI=1S/C27H25F3N6O7S/c1-5-42-25(37)20-9-16(13-31-24(20)43-6-7-44(38)39)21-14-32-26(33-17-10-18(40-3)12-19(11-17)41-4)34-23(21)36-15(2)8-22(35-36)27(28,29)30/h7-14H,5-6H2,1-4H3,(H,32,33,34) |
| InChIKey | DQBJARORFGUFRF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 156.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.59 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|