C44H52O8S2 — CID 87529840
2-[4-(10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)pentanoyloxy]ethanesulfonate;triphenylsulfanium (PubChem CID 87529840) has the molecular formula C44H52O8S2 and a molecular weight of 773.03 g/mol. Its IUPAC name is 2-[4-(10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)pentanoyloxy]ethanesulfonate;triphenylsulfanium.
| Compound Name | 2-[4-(10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)pentanoyloxy]ethanesulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 87529840 |
| Molecular Formula | C44H52O8S2 |
| Molecular Weight | 773.03 g/mol |
| Exact Mass | 772.31 |
| IUPAC Name | 2-[4-(10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)pentanoyloxy]ethanesulfonate;triphenylsulfanium |
| SMILES | CC(CCC(=O)OCCS(=O)(=O)[O-])C1CCC2C3C(=O)CC4CC(=O)CCC4(C)C3CC(=O)C12C.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H38O8S.C18H15S/c1-15(4-7-23(30)34-10-11-35(31,32)33)18-5-6-19-24-20(14-22(29)26(18,19)3)25(2)9-8-17(27)12-16(25)13-21(24)28;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h15-16,18-20,24H,4-14H2,1-3H3,(H,31,32,33);1-15H/q;+1/p-1 |
| InChIKey | PJMOWYNOORYBND-UHFFFAOYSA-M |
| XLogP | 7.86 |
| TPSA | 134.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.03 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|