C21H26N4O7 — CID 87530023
(2S,3S,5S)-2-(1,3-dihydroisoindole-2-carbonyl)-3-(hydroxycarbamoyl)-5-(pyrrolidine-1-carbonyloxy)piperidine-1-carboxylic acid (PubChem CID 87530023) has the molecular formula C21H26N4O7 and a molecular weight of 446.46 g/mol. Its IUPAC name is (2S,3S,5S)-2-(1,3-dihydroisoindole-2-carbonyl)-3-(hydroxycarbamoyl)-5-(pyrrolidine-1-carbonyloxy)piperidine-1-carboxylic acid.
| Compound Name | (2S,3S,5S)-2-(1,3-dihydroisoindole-2-carbonyl)-3-(hydroxycarbamoyl)-5-(pyrrolidine-1-carbonyloxy)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87530023 |
| Molecular Formula | C21H26N4O7 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | (2S,3S,5S)-2-(1,3-dihydroisoindole-2-carbonyl)-3-(hydroxycarbamoyl)-5-(pyrrolidine-1-carbonyloxy)piperidine-1-carboxylic acid |
| SMILES | O=C(NO)[C@H]1C[C@H](OC(=O)N2CCCC2)CN(C(=O)O)[C@@H]1C(=O)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C21H26N4O7/c26-18(22-31)16-9-15(32-21(30)23-7-3-4-8-23)12-25(20(28)29)17(16)19(27)24-10-13-5-1-2-6-14(13)11-24/h1-2,5-6,15-17,31H,3-4,7-12H2,(H,22,26)(H,28,29)/t15-,16-,17-/m0/s1 |
| InChIKey | OIDNRLFEKBOVEA-ULQDDVLXSA-N |
| XLogP | 1.00 |
| TPSA | 139.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|