C25H26F2N2O4 — CID 87530048
trans-(1S,2S)-5-(3,4-difluorophenoxy)-N-hydroxy-2-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)cyclohexane-1-carboxamide (PubChem CID 87530048) has the molecular formula C25H26F2N2O4 and a molecular weight of 456.49 g/mol. Its IUPAC name is trans-(1S,2S)-5-(3,4-difluorophenoxy)-N-hydroxy-2-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)cyclohexane-1-carboxamide.
| Compound Name | trans-(1S,2S)-5-(3,4-difluorophenoxy)-N-hydroxy-2-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 87530048 |
| Molecular Formula | C25H26F2N2O4 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | trans-(1S,2S)-5-(3,4-difluorophenoxy)-N-hydroxy-2-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)cyclohexane-1-carboxamide |
| SMILES | O=C(NO)[C@H]1CC(Oc2ccc(F)c(F)c2)CC[C@@H]1C(=O)N1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H26F2N2O4/c26-22-9-7-19(15-23(22)27)33-18-6-8-20(21(14-18)24(30)28-32)25(31)29-12-10-17(11-13-29)16-4-2-1-3-5-16/h1-5,7,9-10,15,18,20-21,32H,6,8,11-14H2,(H,28,30)/t18?,20-,21-/m0/s1 |
| InChIKey | HWEJJOCIFDPQDF-LLQWEQGGSA-N |
| XLogP | 3.95 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|