C14H19NO5S2 — CID 87530646
5-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3,6-dihydro-2H-pyridin-4-yl]thiophene-2-sulfonic acid (PubChem CID 87530646) has the molecular formula C14H19NO5S2 and a molecular weight of 345.44 g/mol. Its IUPAC name is 5-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3,6-dihydro-2H-pyridin-4-yl]thiophene-2-sulfonic acid.
| Compound Name | 5-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3,6-dihydro-2H-pyridin-4-yl]thiophene-2-sulfonic acid |
|---|---|
| PubChem CID | 87530646 |
| Molecular Formula | C14H19NO5S2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 5-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3,6-dihydro-2H-pyridin-4-yl]thiophene-2-sulfonic acid |
| SMILES | CC(C)(C)OC(=O)N1CC=C(c2ccc(S(=O)(=O)O)s2)CC1 |
| InChI | InChI=1S/C14H19NO5S2/c1-14(2,3)20-13(16)15-8-6-10(7-9-15)11-4-5-12(21-11)22(17,18)19/h4-6H,7-9H2,1-3H3,(H,17,18,19) |
| InChIKey | ZJSKGMVHCFRUAK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|