C25H29N7O — CID 87530678
3-[5-amino-6-[(Z)-N'-(azepan-1-yl)carbamimidoyl]pyrazin-2-yl]-N-benzylbenzamide (PubChem CID 87530678) has the molecular formula C25H29N7O and a molecular weight of 443.56 g/mol. Its IUPAC name is 3-[5-amino-6-[(Z)-N'-(azepan-1-yl)carbamimidoyl]pyrazin-2-yl]-N-benzylbenzamide.
| Compound Name | 3-[5-amino-6-[(Z)-N'-(azepan-1-yl)carbamimidoyl]pyrazin-2-yl]-N-benzylbenzamide |
|---|---|
| PubChem CID | 87530678 |
| Molecular Formula | C25H29N7O |
| Molecular Weight | 443.56 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 3-[5-amino-6-[(Z)-N'-(azepan-1-yl)carbamimidoyl]pyrazin-2-yl]-N-benzylbenzamide |
| SMILES | N/C(=N\N1CCCCCC1)c1nc(-c2cccc(C(=O)NCc3ccccc3)c2)cnc1N |
| InChI | InChI=1S/C25H29N7O/c26-23-22(24(27)31-32-13-6-1-2-7-14-32)30-21(17-28-23)19-11-8-12-20(15-19)25(33)29-16-18-9-4-3-5-10-18/h3-5,8-12,15,17H,1-2,6-7,13-14,16H2,(H2,26,28)(H2,27,31)(H,29,33) |
| InChIKey | ABHHLPSCJSEXEV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.56 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|