About 5-tert-butylsulfanyl-4,4-dimethylpentan-2-one
5-tert-butylsulfanyl-4,4-dimethylpentan-2-one (PubChem CID 87530753) has the molecular formula C11H22OS
and a molecular weight of 202.36 g/mol. Its IUPAC name is 5-tert-butylsulfanyl-4,4-dimethylpentan-2-one.
Molecular Properties
| Compound Name | 5-tert-butylsulfanyl-4,4-dimethylpentan-2-one |
| PubChem CID | 87530753 |
| Molecular Formula | C11H22OS |
| Molecular Weight | 202.36 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 5-tert-butylsulfanyl-4,4-dimethylpentan-2-one |
| SMILES | CC(=O)CC(C)(C)CSC(C)(C)C |
| InChI | InChI=1S/C11H22OS/c1-9(12)7-11(5,6)8-13-10(2,3)4/h7-8H2,1-6H3 |
| InChIKey | OHHRXTQOUNMIFB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-tert-butylsulfanyl-4,4-dimethylpentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butylsulfanyl-4,4-dimethylpentan-2-one?
The IUPAC name of 5-tert-butylsulfanyl-4,4-dimethylpentan-2-one (CID 87530753) is 5-tert-butylsulfanyl-4,4-dimethylpentan-2-one.
What is the SMILES notation for 5-tert-butylsulfanyl-4,4-dimethylpentan-2-one?
The canonical SMILES for 5-tert-butylsulfanyl-4,4-dimethylpentan-2-one is CC(=O)CC(C)(C)CSC(C)(C)C.
What is the InChIKey of 5-tert-butylsulfanyl-4,4-dimethylpentan-2-one?
The InChIKey is OHHRXTQOUNMIFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22OS/c1-9(12)7-11(5,6)8-13-10(2,3)4/h7-8H2,1-6H3.
What are the key properties of 5-tert-butylsulfanyl-4,4-dimethylpentan-2-one?
5-tert-butylsulfanyl-4,4-dimethylpentan-2-one has a molecular weight of 202.36 g/mol, XLogP of 3.52, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butylsulfanyl-4,4-dimethylpentan-2-one is sourced from PubChem (CID 87530753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).